![[ICO]](/icons/blank.gif) | Name | Last modified | Size | Description |
|
![[PARENTDIR]](/icons/back.gif) | Parent Directory | | - | |
![[DIR]](/icons/folder.gif) | Naj_za_trenutek_odlozi_delo/ | 2016-09-24 13:01 | - | |
![[DIR]](/icons/folder.gif) | 081122_OKULT/ | 2016-09-24 13:01 | - | |
![[SND]](/icons/sound2.gif) | 20140412 - DJ GRAFITI.mp3 | 2014-04-18 17:21 | 172M | |
![[SND]](/icons/sound2.gif) | 20140329 - DJ GRAFITI (WORK IN PROGRESS).mp3 | 2014-03-31 14:08 | 157M | |
![[SND]](/icons/sound2.gif) | 20100311 ODPRTA KOMPILACIJA.mp3 | 2014-03-29 19:31 | 87M | |
![[SND]](/icons/sound2.gif) | 201403222000 - DJ GRAFITI (ZORMAN).mp3 | 2014-03-24 16:10 | 158M | |
![[SND]](/icons/sound2.gif) | 20140313 DJ GRAFITI - MAZZY STAR.mp3 | 2014-03-17 13:59 | 166M | |
![[SND]](/icons/sound2.gif) | 20140308 DJ GRAFITI (2h 01).mp3 | 2014-03-11 16:39 | 167M | |
![[SND]](/icons/sound2.gif) | 20140301 2 KULTURNA EVRA (1h 54).mp3 | 2014-03-04 17:47 | 157M | |
![[SND]](/icons/sound2.gif) | 20140222 JOHNNY CASH (1h 56).mp3 | 2014-02-24 19:51 | 160M | |
![[SND]](/icons/sound2.gif) | 20140215 DJ GRAFITI (2h 02).mp3 | 2014-02-17 21:37 | 168M | |
![[SND]](/icons/sound2.gif) | 20140208 DJ GRAFITI (1h 56).mp3 | 2014-02-10 19:07 | 159M | |
![[SND]](/icons/sound2.gif) | 20140125 DJ GRAFITI.mp3 | 2014-01-27 20:05 | 181M | |
![[SND]](/icons/sound2.gif) | 20140125 DJ GRAFITI (2h 11).mp3 | 2014-01-27 20:02 | 36M | |
![[SND]](/icons/sound2.gif) | 20140118 DJ GRAFITI (2h 01).mp3 | 2014-01-20 17:02 | 167M | |
![[SND]](/icons/sound2.gif) | 20140111 DJ GRAFITI-LUKE VIBERT (1h 57).mp3 | 2014-01-13 16:52 | 161M | |
![[SND]](/icons/sound2.gif) | 20140104 DJ GRAFITI (2h 02).mp3 | 2014-01-06 17:01 | 168M | |
![[SND]](/icons/sound2.gif) | 20131228 DJ GRAFITI (2h 02).mp3 | 2013-12-30 18:26 | 169M | |
![[SND]](/icons/sound2.gif) | 20131221 DJ GRAFITI - SLO SCENA 2013 (1h 57).mp3 | 2013-12-22 21:39 | 161M | |
![[SND]](/icons/sound2.gif) | 20131214 NICOLAS JAAR.mp3 | 2013-12-16 20:00 | 167M | |
![[SND]](/icons/sound2.gif) | 20131207 dj grafiti.mp3 | 2013-12-09 18:36 | 125M | |
![[SND]](/icons/sound2.gif) | 20131130 DJ GRAFIRTI.mp3 | 2013-12-03 18:50 | 168M | |
![[SND]](/icons/sound2.gif) | 20131123 dj grafiti (1h 59).mp3 | 2013-11-25 17:10 | 164M | |
![[SND]](/icons/sound2.gif) | 20131116 dj grafiti-bevk.mp3 | 2013-11-18 20:50 | 169M | |
![[SND]](/icons/sound2.gif) | 20131108 KM 13.mp3 | 2013-11-11 17:17 | 37M | |
![[SND]](/icons/sound2.gif) | 20131109 KM 13 GRAFITI.mp3 | 2013-11-11 17:15 | 170M | |
![[SND]](/icons/sound2.gif) | 20131102 DJ GRAFITI ANTHONY HEGERTY.mp3 | 2013-11-05 12:18 | 153M | |
![[SND]](/icons/sound2.gif) | 20131026 DJ GRAFITI-GUSGUS.mp3 | 2013-10-29 11:45 | 162M | |
![[SND]](/icons/sound2.gif) | 20131019 DJ GRAFITI.mp3 | 2013-10-23 13:52 | 170M | |
![[SND]](/icons/sound2.gif) | 20131012 DJ GRAFITI (2h 04).mp3 | 2013-10-14 20:20 | 171M | |
![[SND]](/icons/sound2.gif) | 20131005 DJ GRAFITI (1h 57).mp3 | 2013-10-07 20:16 | 162M | |
![[SND]](/icons/sound2.gif) | 20130928 DJ GRAFITI (2h 00).mp3 | 2013-09-30 14:37 | 165M | |
![[SND]](/icons/sound2.gif) | 20130921 DJ GRAFIRTI-SENSIENT (1h 58).mp3 | 2013-09-23 17:18 | 163M | |
![[SND]](/icons/sound2.gif) | 20090502 dj grafiti_etiopski saksofon.mp3 | 2013-08-19 14:12 | 113M | |
![[SND]](/icons/sound2.gif) | 20080712 DJ GRAFITI_KLAUS NOMI.mp3 | 2013-08-12 13:14 | 110M | |
![[SND]](/icons/sound2.gif) | 20100630 jello-spoken word (1h 41)-p.mp3 | 2013-08-06 13:36 | 234M | |
![[SND]](/icons/sound2.gif) | 20091114 dj grafiti_warp.mp3 | 2013-07-29 15:03 | 76M | |
![[SND]](/icons/sound2.gif) | 20100327 DJ GRAFITI kwaito.mp3 | 2013-07-22 13:57 | 110M | |
![[SND]](/icons/sound2.gif) | 20100605 DJ GRAFITI GPHILIP GLAS.mp3 | 2013-07-12 15:47 | 110M | |
![[SND]](/icons/sound2.gif) | 20130629 dJ GRAFITI (1h 50).mp3 | 2013-07-03 19:25 | 152M | |
![[SND]](/icons/sound2.gif) | 20130622 DJ GRAFITI (2h 07).mp3 | 2013-06-24 18:37 | 175M | |
![[SND]](/icons/sound2.gif) | 20130615 psytrance (1h 57).mp3 | 2013-06-17 16:13 | 161M | |
![[SND]](/icons/sound2.gif) | 20130608 DJ GRAFITI (2h 06).mp3 | 2013-06-10 18:55 | 173M | |
![[SND]](/icons/sound2.gif) | 20130601 DJ GRAFITI (2h 00).mp3 | 2013-06-03 18:30 | 165M | |
![[SND]](/icons/sound2.gif) | 130525 PRIMAL SCREAM (2h 00).mp3 | 2013-05-28 11:28 | 166M | |
![[SND]](/icons/sound2.gif) | 20130518 JAZZ CERKNO (1h 57).mp3 | 2013-05-20 16:05 | 161M | |
![[SND]](/icons/sound2.gif) | 20130511 DJ GRAFITI (1h 59).mp3 | 2013-05-13 17:53 | 163M | |
![[SND]](/icons/sound2.gif) | 20130504 SHUTKA (2h 01).mp3 | 2013-05-06 16:13 | 167M | |
![[SND]](/icons/sound2.gif) | 20130427 DJ GRAFITI (1h 53).mp3 | 2013-04-29 17:01 | 156M | |
![[SND]](/icons/sound2.gif) | 20130420 DJ GRAFITI (2h 00).mp3 | 2013-04-22 16:34 | 165M | |
![[SND]](/icons/sound2.gif) | 20130413 DJ GRAFITI-COIL (1h 59).mp3 | 2013-04-15 13:25 | 164M | |
![[SND]](/icons/sound2.gif) | 20130406 DJ GRAFITI (1h 51).mp3 | 2013-04-08 18:43 | 153M | |
![[SND]](/icons/sound2.gif) | 20130330200001-DJ GRAFITI.mp3 | 2013-04-02 16:03 | 165M | |
![[SND]](/icons/sound2.gif) | 20130323 DJ GRAFITI-KOMPOS (1h 55).mp3 | 2013-03-25 19:09 | 159M | |
![[SND]](/icons/sound2.gif) | 20130316 DJ GRAFITI (2h 05).mp3 | 2013-03-18 19:07 | 172M | |
![[SND]](/icons/sound2.gif) | 20130309 DJ GRAFITI (2h 02).mp3 | 2013-03-11 21:51 | 168M | |
![[SND]](/icons/sound2.gif) | 20130302 DJ GRAFITI (2h 00).mp3 | 2013-03-04 15:21 | 165M | |
![[SND]](/icons/sound2.gif) | 20130223 MOLINA (1h 52).mp3 | 2013-02-25 16:44 | 154M | |
![[SND]](/icons/sound2.gif) | 20130216 KRALLICE (1h 56).mp3 | 2013-02-18 15:48 | 160M | |
![[SND]](/icons/sound2.gif) | 20130209 SMEGMA (3h 01).mp3 | 2013-02-11 17:15 | 250M | |
![[SND]](/icons/sound2.gif) | 20121208 BEGNAGRAD_INTERVJU.mp3 | 2013-02-05 13:18 | 162M | |
![[SND]](/icons/sound2.gif) | 20130202 IMPRO GRAFITI (1h 55).mp3 | 2013-02-04 16:23 | 159M | |
![[SND]](/icons/sound2.gif) | 20130126 DJ GRAFITI (2h 01).mp3 | 2013-01-28 19:49 | 167M | |
![[SND]](/icons/sound2.gif) | 20121013 dj-grafiti-joe-colley.mp3 | 2013-01-22 20:17 | 137M | |
![[SND]](/icons/sound2.gif) | 20120721 dj-grafiti-the-brian-jonestown-massacre.mp3 | 2013-01-22 20:17 | 134M | |
![[SND]](/icons/sound2.gif) | 20130119 DJ GRAFITI (2h 06).mp3 | 2013-01-21 15:50 | 173M | |
![[SND]](/icons/sound2.gif) | 20130112 BRATA COEN (1h 59).mp3 | 2013-01-14 16:41 | 165M | |
![[SND]](/icons/sound2.gif) | 20130105 DJ GRAFITI (2h 02).mp3 | 2013-01-08 16:23 | 168M | |
![[SND]](/icons/sound2.gif) | 20121229 DJ GRAFITI-SLO 2012 (2h 07).mp3 | 2013-01-08 16:04 | 176M | |
![[SND]](/icons/sound2.gif) | 20121222 DJ GRAFITI-SLO PREGLED 2012 (1h 55).mp3 | 2012-12-27 18:36 | 158M | |
![[SND]](/icons/sound2.gif) | 20121215 DJ GRAFITI-ZAGOR (1h 56).mp3 | 2012-12-17 19:22 | 161M | |
![[SND]](/icons/sound2.gif) | 20121201 ONTERVJABBIT (1h 59).mp3 | 2012-12-03 17:48 | 163M | |
![[SND]](/icons/sound2.gif) | 20121124 BOGDAN BENIGAR (2h 01).mp3 | 2012-11-26 13:03 | 166M | |
![[SND]](/icons/sound2.gif) | 20121110 DJ GRAFITI-KM 12-FINALE (1h 59).mp3 | 2012-11-12 12:59 | 164M | |
![[SND]](/icons/sound2.gif) | 20121103 DJ GRAFITI (2h 00).mp3 | 2012-11-05 15:53 | 165M | |
![[SND]](/icons/sound2.gif) | 20121027 SIX ORGANS OF ADDMITANCE (1h 56).mp3 | 2012-10-29 14:13 | 160M | |
![[SND]](/icons/sound2.gif) | 20121020 DJ GRAFITI (1h 59).mp3 | 2012-10-22 15:29 | 164M | |
![[SND]](/icons/sound2.gif) | 20121006 DJ GRAFITI (2h 01).mp3 | 2012-10-08 15:06 | 166M | |
![[SND]](/icons/sound2.gif) | 20120929 JUSTIN BROADRICK (1h 57).mp3 | 2012-10-01 16:10 | 161M | |
![[SND]](/icons/sound2.gif) | 120922 dj grafiti.mp3 | 2012-09-24 12:23 | 225M | |
![[SND]](/icons/sound2.gif) | 20120915 FOE (1h 55).mp3 | 2012-09-17 18:12 | 159M | |
![[SND]](/icons/sound2.gif) | 20120811 dj grafiti.mp3 | 2012-08-20 17:53 | 137M | |
![[SND]](/icons/sound2.gif) | 20120818 DJ GRAFITI-ZAGORICNIK (1h 59).mp3 | 2012-08-20 17:51 | 165M | |
![[SND]](/icons/sound2.gif) | 120811 dj grafiti 120811.mp3 | 2012-08-10 11:23 | 165M | |
![[SND]](/icons/sound2.gif) | 20120804 DJ GRAFITI-KATARINA (1h 59).mp3 | 2012-08-06 14:56 | 164M | |
![[SND]](/icons/sound2.gif) | 20120728 DJ GRAFITI-WOODY GUTHRIE (1h 43).mp3 | 2012-07-30 15:25 | 142M | |
![[SND]](/icons/sound2.gif) | 20120714 RANCID (1h 46).mp3 | 2012-07-17 18:09 | 147M | |
![[SND]](/icons/sound2.gif) | 20120707 DJ GRAFITI-SPIKE LEE (2h 00).mp3 | 2012-07-17 18:03 | 165M | |
![[SND]](/icons/sound2.gif) | 20120630 GRAFITI-BEVK (1h 54).mp3 | 2012-07-02 15:41 | 157M | |
![[SND]](/icons/sound2.gif) | 20120623 DJ GRAFITI-TECH-NOISE (1h 57).mp3 | 2012-06-26 17:51 | 162M | |
![[SND]](/icons/sound2.gif) | 20120616 PRIMAVERA 2012 (2h 00).mp3 | 2012-06-18 15:26 | 166M | |
![[SND]](/icons/sound2.gif) | 20120609 M83 (2h 02).mp3 | 2012-06-11 14:42 | 168M | |
![[SND]](/icons/sound2.gif) | 20120602 DJ GRAFITI-VERBUC (2h 03).mp3 | 2012-06-04 10:47 | 169M | |
![[SND]](/icons/sound2.gif) | 20120526 DJ GRAFITI-DROLJC (2h 01).mp3 | 2012-05-28 18:10 | 167M | |
![[SND]](/icons/sound2.gif) | 20120512 DJ GRAFITI JAZZ CERKNO 12 (1h 58).mp3 | 2012-05-14 18:55 | 163M | |
![[SND]](/icons/sound2.gif) | 20120505 DJ GRAFITI DINO (2h 05).mp3 | 2012-05-07 18:46 | 172M | |
![[SND]](/icons/sound2.gif) | 20120505 GRAFITI KOMPOS (1h 59).mp3 | 2012-05-07 18:45 | 165M | |
![[SND]](/icons/sound2.gif) | 20120428 DJ GRAFITI-PUCELJ (1h 59).mp3 | 2012-04-30 11:19 | 165M | |
![[SND]](/icons/sound2.gif) | 20120428 DJ GRAFITI-MONOLAKE (2h 02).mp3 | 2012-04-30 11:18 | 168M | |
![[SND]](/icons/sound2.gif) | 20120421 DJ GRAFITI-PINCH (2h 04).mp3 | 2012-04-23 19:16 | 171M | |
![[SND]](/icons/sound2.gif) | 20120420 DJ GRAFITI-COLTRANE (2h 00).mp3 | 2012-04-23 19:16 | 165M | |
![[SND]](/icons/sound2.gif) | 20120414 HOCEVAR (1h 59).mp3 | 2012-04-16 19:23 | 164M | |
![[SND]](/icons/sound2.gif) | 20120414 WILD STYLE (2h 02).mp3 | 2012-04-16 19:22 | 168M | |
![[SND]](/icons/sound2.gif) | 20120407 DJ GRAFITI-PINA (1h 56).mp3 | 2012-04-10 15:32 | 160M | |
![[SND]](/icons/sound2.gif) | 20120407 DJ GRAFITI MANOREXIA.mp3 | 2012-04-06 14:34 | 270M | |
![[SND]](/icons/sound2.gif) | 20120331 DJ GRAFITI KOMPOS (1h 58).mp3 | 2012-04-02 14:22 | 218M | |
![[SND]](/icons/sound2.gif) | 20120331 DJ GRAFITI ZZW (2h 01).mp3 | 2012-04-02 14:22 | 222M | |
![[SND]](/icons/sound2.gif) | 20120324 DJ GRAFITI-HOCEVAR (2h 06).mp3 | 2012-03-26 14:20 | 232M | |
![[SND]](/icons/sound2.gif) | 20120324 DJGRAFFITI-eccentric-soul-za-WWW.mp3 | 2012-03-26 13:30 | 252M | |
![[SND]](/icons/sound2.gif) | 20120317 ATDI (1h 31).mp3 | 2012-03-19 18:35 | 167M | |
![[SND]](/icons/sound2.gif) | 20120317 CRASS (2h 01).mp3 | 2012-03-19 18:35 | 223M | |
![[SND]](/icons/sound2.gif) | 20120310 DJ GRAFITI-BREAKESTRA (2h 03).mp3 | 2012-03-12 17:30 | 225M | |
![[SND]](/icons/sound2.gif) | 20120310 DJ GRAFITI-STRESS (2h 03).mp3 | 2012-03-12 17:29 | 227M | |
![[SND]](/icons/sound2.gif) | 20120303 KARLOVCEC (1h 47).mp3 | 2012-03-05 19:50 | 196M | |
![[SND]](/icons/sound2.gif) | 20120303 TRESK 3-DRUGIC (2h 09).mp3 | 2012-03-05 19:49 | 238M | |
![[SND]](/icons/sound2.gif) | 20120225 DEUS (2h 15).mp3 | 2012-02-27 16:19 | 247M | |
![[SND]](/icons/sound2.gif) | 20120225 TRESK 3 (2h 01).mp3 | 2012-02-27 16:18 | 222M | |
![[SND]](/icons/sound2.gif) | 20120218 ETTA JAMES (1h 43).mp3 | 2012-02-20 14:26 | 190M | |
![[SND]](/icons/sound2.gif) | 20120218 FLOSSIN (1h 59).mp3 | 2012-02-20 14:25 | 220M | |
![[SND]](/icons/sound2.gif) | 20120211 PROFOUND LORE (2h 07).mp3 | 2012-02-13 20:03 | 234M | |
![[SND]](/icons/sound2.gif) | 20120211 JANEK SHAEFER (1h 41).mp3 | 2012-02-13 20:03 | 186M | |
![[SND]](/icons/sound2.gif) | 20120204 DREXCIYA (2h 03).mp3 | 2012-02-06 15:25 | 226M | |
![[SND]](/icons/sound2.gif) | 20120204 MACO (2h 33).mp3 | 2012-02-06 15:24 | 281M | |
![[SND]](/icons/sound2.gif) | 20120128 DJ GRAFITI-JELENA (2h 00).mp3 | 2012-01-30 15:06 | 221M | |
![[SND]](/icons/sound2.gif) | 20120128 GRAFITI-BADOVINC (1h 51).mp3 | 2012-01-30 15:06 | 204M | |
![[SND]](/icons/sound2.gif) | 0128200001 HESSLE AUDIO.mp3 | 2012-01-29 22:42 | 220M | |
![[SND]](/icons/sound2.gif) | 20120121 DJ GRAFITI-CYC (1h 42).mp3 | 2012-01-23 15:51 | 187M | |
![[SND]](/icons/sound2.gif) | 20120121 POEZIJA IN GLASBA (1h 49).mp3 | 2012-01-23 15:51 | 200M | |
![[SND]](/icons/sound2.gif) | 20120114 DJ GRAFITI-JIZAH (2h 00).mp3 | 2012-01-16 17:33 | 220M | |
![[SND]](/icons/sound2.gif) | 20120114 DJ GRAFITI-BEVK (2h 00).mp3 | 2012-01-16 17:32 | 220M | |
![[SND]](/icons/sound2.gif) | 20120107 DJ GRAFITI2 (2h 11).mp3 | 2012-01-09 14:08 | 241M | |
![[SND]](/icons/sound2.gif) | 20120101 NAJ NAJ 2011-domaci (1h 49).mp3 | 2012-01-03 15:22 | 200M | |
![[SND]](/icons/sound2.gif) | 20120101 NAJ NAJ 2011-TUJI (1h 45).mp3 | 2012-01-03 15:21 | 193M | |
![[SND]](/icons/sound2.gif) | 20111224 DAVID LYNCH (2h 00).mp3 | 2011-12-27 18:39 | 222M | |
![[SND]](/icons/sound2.gif) | 20111224 HOCEVAR (2h 01).mp3 | 2011-12-27 18:37 | 223M | |
![[SND]](/icons/sound2.gif) | 20111217 JAZZLAND (1h 56).mp3 | 2011-12-20 16:37 | 214M | |
![[SND]](/icons/sound2.gif) | 20111217 SOUTHLORD (1h 55).mp3 | 2011-12-20 16:36 | 212M | |
![[SND]](/icons/sound2.gif) | 20111210 DJ GRAFITI-CYC (1h 59).mp3 | 2011-12-13 16:46 | 219M | |
![[SND]](/icons/sound2.gif) | 20111210 DJ GRAFITI-katarina (2h 01).mp3 | 2011-12-13 16:45 | 222M | |
![[SND]](/icons/sound2.gif) | 20111203 DJ GRAFITI-HOCEVAR (1h 51).mp3 | 2011-12-05 15:48 | 204M | |
![[SND]](/icons/sound2.gif) | 20111203 DJ GRAFITI -BOGDAN (2h 01).mp3 | 2011-12-05 15:47 | 222M | |
![[SND]](/icons/sound2.gif) | 20111126 PROPHECY PRODUCTIONS (1h 52).mp3 | 2011-11-28 14:04 | 205M | |
![[SND]](/icons/sound2.gif) | 20111126 APHEX TWIN (1h 57).mp3 | 2011-11-28 14:03 | 216M | |
![[SND]](/icons/sound2.gif) | 20111119 KAYO DOT (1h 59).mp3 | 2011-11-21 17:42 | 218M | |
![[SND]](/icons/sound2.gif) | 20111119 LUKA Z (2h 00).mp3 | 2011-11-21 17:42 | 221M | |
![[SND]](/icons/sound2.gif) | 20111112 DJ GRAFITI1 (1h 57).mp3 | 2011-11-14 15:31 | 216M | |
![[SND]](/icons/sound2.gif) | 20111112 DJ GRAFITI-SKA (1h 55).mp3 | 2011-11-14 15:31 | 212M | |
![[SND]](/icons/sound2.gif) | 20111105 ghost-km11 (2h 52).mp3 | 2011-11-07 16:44 | 395M | |
![[SND]](/icons/sound2.gif) | 20111029 DJ GRAFITI-DINO (1h 59).mp3 | 2011-11-01 14:27 | 220M | |
![[SND]](/icons/sound2.gif) | 20111029 DJ GRAFITI-BADOVINC (2h 06).mp3 | 2011-11-01 14:27 | 232M | |
![[SND]](/icons/sound2.gif) | 20111022 DJ GRAFITI1-FERCERA(2h 04).mp3 | 2011-10-24 16:20 | 227M | |
![[SND]](/icons/sound2.gif) | 20111022 US3 fercera.mp3 | 2011-10-24 16:19 | 217M | |
![[SND]](/icons/sound2.gif) | 20111015 DJ GRAFITI-2 (2h 01).mp3 | 2011-10-17 15:23 | 222M | |
![[SND]](/icons/sound2.gif) | 20111015 DJ GRAFITI-REZNOR (2h 05).mp3 | 2011-10-17 15:22 | 230M | |
![[SND]](/icons/sound2.gif) | 20111008 DJ GARFITI 2 (2h 01).mp3 | 2011-10-10 17:28 | 223M | |
![[SND]](/icons/sound2.gif) | 20111008 DJ GARFITI 1 (1h 59).mp3 | 2011-10-10 17:27 | 219M | |
![[SND]](/icons/sound2.gif) | 20111001 DJ GRAFITI 1.mp3 | 2011-10-03 17:30 | 215M | |
![[SND]](/icons/sound2.gif) | 20111001 DJ GRAFITI 2.mp3 | 2011-10-03 17:30 | 217M | |
![[SND]](/icons/sound2.gif) | 20110924 - DJ GRAFITI - NOTNOTFUN (KATARINA).mp3 | 2011-09-28 14:38 | 232M | |
![[SND]](/icons/sound2.gif) | 110924 - DJ GRAFITI - DAVE SITEK.mp3 | 2011-09-28 14:24 | 202M | |
![[SND]](/icons/sound2.gif) | 20110924 grafit_20.mp3 | 2011-09-23 17:21 | 253M | |
![[SND]](/icons/sound2.gif) | 20110917 DJ GRAFITI POLONA (2h 03).mp3 | 2011-09-19 16:30 | 226M | |
![[SND]](/icons/sound2.gif) | 20110910 DJ GRAFITI CYC (1h 49).mp3 | 2011-09-12 15:54 | 201M | |
![[SND]](/icons/sound2.gif) | 20110903 DJ GARFITI MUANIS (1h 56).mp3 | 2011-09-05 14:31 | 214M | |
![[SND]](/icons/sound2.gif) | 20110827 DJ GRAFITI KAJZER (1h 58).mp3 | 2011-08-29 16:16 | 163M | |
![[SND]](/icons/sound2.gif) | 20110827 TUAREGI (1h 48).mp3 | 2011-08-29 16:15 | 148M | |
![[SND]](/icons/sound2.gif) | 20110820 SEPULTURA (1h 25).mp3 | 2011-08-22 17:04 | 117M | |
![[SND]](/icons/sound2.gif) | 20110820 DJ GRAFITI-BORKA (1h 57).mp3 | 2011-08-22 17:02 | 162M | |
![[SND]](/icons/sound2.gif) | 20110813 dj grafiti-zagoricnik (1h 59).mp3 | 2011-08-16 19:24 | 164M | |
![[SND]](/icons/sound2.gif) | 20110813 dj grafiti-kompos (1h 58).mp3 | 2011-08-16 19:23 | 163M | |
![[SND]](/icons/sound2.gif) | 20110813 DJ Grafiti- drugi.mp3 | 2011-08-14 16:33 | 163M | |
![[SND]](/icons/sound2.gif) | 20110806 ZS (1h 49).mp3 | 2011-08-08 16:14 | 151M | |
![[SND]](/icons/sound2.gif) | 20110806 DJ GRAFITI-BADOVINC (2h 00).mp3 | 2011-08-08 16:13 | 166M | |
![[SND]](/icons/sound2.gif) | 20110730 BEIRUT (1h 55).mp3 | 2011-08-01 14:04 | 159M | |
![[SND]](/icons/sound2.gif) | 20110730 dj grafiti-kompos (2h 00).mp3 | 2011-08-01 14:03 | 165M | |
![[SND]](/icons/sound2.gif) | 20110723 dj grafiti (1h 57).mp3 | 2011-07-25 17:18 | 161M | |
![[SND]](/icons/sound2.gif) | 20110723 dj grafiti legende rapa (1h 57).mp3 | 2011-07-25 17:18 | 161M | |
![[SND]](/icons/sound2.gif) | 2020110716 SONNY VINCENT (1h 57).mp3 | 2011-07-18 14:50 | 161M | |
![[SND]](/icons/sound2.gif) | 20110716 DJ HIBRIDI 4.mp3 | 2011-07-18 11:41 | 287M | |
![[SND]](/icons/sound2.gif) | 20110709 GHOST-DINO (4h 32).mp3 | 2011-07-11 17:04 | 374M | |
![[SND]](/icons/sound2.gif) | 20110702 dj grafiti 2 (2h 02).mp3 | 2011-07-04 17:58 | 168M | |
![[SND]](/icons/sound2.gif) | 20110702 dj grafiti 1 (1h 59).mp3 | 2011-07-04 17:57 | 164M | |
![[SND]](/icons/sound2.gif) | 20110623 BOGDAN (2h 00).mp3 | 2011-06-27 18:53 | 165M | |
![[SND]](/icons/sound2.gif) | 20110618 DJ GRAFITI-HOCEVAR (2h 00).mp3 | 2011-06-20 16:31 | 165M | |
![[SND]](/icons/sound2.gif) | 20110618 FUCKED UP (2h 07).mp3 | 2011-06-20 16:31 | 175M | |
![[SND]](/icons/sound2.gif) | 20110611 GIL SCOTT HERON (1h 58).mp3 | 2011-06-13 15:47 | 163M | |
![[SND]](/icons/sound2.gif) | 20110611 DJ GRAFITI-BADOVINAC (1h 55).mp3 | 2011-06-13 15:47 | 159M | |
![[SND]](/icons/sound2.gif) | 20110604 DJ GRAFITI MARIO (1h 59).mp3 | 2011-06-06 17:55 | 165M | |
![[SND]](/icons/sound2.gif) | 20110604 DJ GRAFITI CYC-PRESI (2h 01).mp3 | 2011-06-06 17:54 | 166M | |
![[SND]](/icons/sound2.gif) | 20110528 DJ GRAFITI DINO (2h 09).mp3 | 2011-05-30 13:51 | 178M | |
![[SND]](/icons/sound2.gif) | 20110528 DJ GRAFITI1 (1h 49).mp3 | 2011-05-30 13:50 | 151M | |
![[SND]](/icons/sound2.gif) | 20110514 GANG GANG DANCE (1h 57).mp3 | 2011-05-16 15:31 | 161M | |
![[SND]](/icons/sound2.gif) | 20110514 DJ GRAFITI LUKA (1h 53).mp3 | 2011-05-16 15:30 | 156M | |
![[SND]](/icons/sound2.gif) | 20110430 DJ GRAFITI-JIZAH (1h 58).mp3 | 2011-05-03 15:48 | 163M | |
![[SND]](/icons/sound2.gif) | 20110430 SLOVENSKI JAZZ (1h 52).mp3 | 2011-05-03 15:48 | 154M | |
![[SND]](/icons/sound2.gif) | 20110423 DJ GRAFITI DINO (2h 04).mp3 | 2011-04-25 18:17 | 170M | |
![[SND]](/icons/sound2.gif) | 20110423 JESUS LIZARD (1h 53).mp3 | 2011-04-25 18:16 | 155M | |
![[SND]](/icons/sound2.gif) | 20110416 DJ GRAFITI BADOVINC (1h 50).mp3 | 2011-04-18 18:25 | 152M | |
![[SND]](/icons/sound2.gif) | 20110416 DJ GRAFITI 2 (1h 56).mp3 | 2011-04-18 18:25 | 160M | |
![[SND]](/icons/sound2.gif) | 20110409 zeitkratzer (1h 58).mp3 | 2011-04-11 14:31 | 163M | |
![[SND]](/icons/sound2.gif) | 20110409 hocevar (1h 59).mp3 | 2011-04-11 14:30 | 165M | |
![[SND]](/icons/sound2.gif) | 20110402 DJ GRAFITI (1h 54).mp3 | 2011-04-04 18:13 | 157M | |
![[SND]](/icons/sound2.gif) | 20110402 GRAFITI LUKA.mp3 | 2011-04-04 18:13 | 178M | |
![[SND]](/icons/sound2.gif) | 20110326 GILBERTO GIL (2h 01).mp3 | 2011-03-28 13:47 | 167M | |
![[SND]](/icons/sound2.gif) | 20110326 BONOBO (2h 00).mp3 | 2011-03-28 13:46 | 165M | |
![[SND]](/icons/sound2.gif) | 20110319 TIM BARRY (1h 55).mp3 | 2011-03-21 12:57 | 159M | |
![[SND]](/icons/sound2.gif) | 20110319 FABRIC (2h 02).mp3 | 2011-03-21 12:56 | 169M | |
![[SND]](/icons/sound2.gif) | 20110312 GHOST-DINO (4h 40).mp3 | 2011-03-15 14:47 | 385M | |
![[SND]](/icons/sound2.gif) | 20110312 GHOST-DINO.mp3 | 2011-03-15 14:46 | 159M | |
![[SND]](/icons/sound2.gif) | 20110305 DJ GRAFITI JIZAH (1h 57).mp3 | 2011-03-07 13:43 | 162M | |
![[SND]](/icons/sound2.gif) | 20110305 DJ GRAFITI TIT (2h 00).mp3 | 2011-03-07 13:42 | 165M | |
![[SND]](/icons/sound2.gif) | 20110226 KYUSS (1h 54).mp3 | 2011-02-28 17:11 | 157M | |
![[SND]](/icons/sound2.gif) | 20110226-DJGRAFITI 22.00-oddaja.mp3 | 2011-02-28 16:27 | 251M | |
![[SND]](/icons/sound2.gif) | 20110219 ROLF JULIUS (2h 00).mp3 | 2011-02-21 13:43 | 165M | |
![[SND]](/icons/sound2.gif) | 20110219 Rephlex (2h 00).mp3 | 2011-02-21 13:42 | 163M | |
![[SND]](/icons/sound2.gif) | 20110219 UC-56 (110219-KOMPOSH).mp3 | 2011-02-15 14:36 | 1.4M | |
![[SND]](/icons/sound2.gif) | 20110212 DJ GRAFITI (1h 54).mp3 | 2011-02-14 17:12 | 157M | |
![[SND]](/icons/sound2.gif) | 20110212 DINO (1h 58).mp3 | 2011-02-14 17:11 | 163M | |
![[SND]](/icons/sound2.gif) | 20110205 RELAPSE RECORDS.mp3 | 2011-02-07 14:20 | 145M | |
![[SND]](/icons/sound2.gif) | 20110204 UC-58 (TRACES-RADIO CONA).mp3 | 2011-02-07 13:49 | 820K | |
![[SND]](/icons/sound2.gif) | 20110129 KOMPOS.mp3 | 2011-01-31 16:57 | 163M | |
![[SND]](/icons/sound2.gif) | 20110129 BROADCAST.mp3 | 2011-01-31 16:57 | 162M | |
![[SND]](/icons/sound2.gif) | 110129 DJ GRAFITI UC-56 (DJ KATARINA).mp3 | 2011-01-26 15:28 | 1.7M | |
![[SND]](/icons/sound2.gif) | 20110122 BEJAR (1h 59).mp3 | 2011-01-24 17:04 | 165M | |
![[SND]](/icons/sound2.gif) | 20110122 JIZAH (1h 55).mp3 | 2011-01-24 17:04 | 159M | |
![[SND]](/icons/sound2.gif) | 20110115 JAZZANOVA (1h 59).mp3 | 2011-01-17 16:53 | 165M | |
![[SND]](/icons/sound2.gif) | 20110115 ISRAEL VIBRATION (1h 55).mp3 | 2011-01-17 16:52 | 159M | |
![[SND]](/icons/sound2.gif) | 20110108 CPT.BEEFHEART.mp3 | 2011-01-10 18:17 | 334M | |
![[SND]](/icons/sound2.gif) | 20110101 GHOST NAJ MUSKA 2010.mp3 | 2011-01-03 16:33 | 324M | |
![[SND]](/icons/sound2.gif) | 20101218 OF MONMTREAL.mp3 | 2010-12-20 16:55 | 146M | |
![[SND]](/icons/sound2.gif) | 20101218 DE LA SOUL.mp3 | 2010-12-20 16:54 | 148M | |
![[SND]](/icons/sound2.gif) | 20101211 ROPOTARNICA 2.mp3 | 2010-12-13 17:23 | 170M | |
![[SND]](/icons/sound2.gif) | 20101211 GRAFITI 20.00.mp3 | 2010-12-13 17:22 | 164M | |
![[SND]](/icons/sound2.gif) | 101204 3EF DJ GRAFFITI.mp3 | 2010-12-07 13:33 | 2.7M | |
![[SND]](/icons/sound2.gif) | 20101204 MATT ELLIOT.mp3 | 2010-12-06 15:46 | 176M | |
![[SND]](/icons/sound2.gif) | 20101204 GRAFICNE MAJA.mp3 | 2010-12-06 15:45 | 157M | |
![[SND]](/icons/sound2.gif) | 20101127 BADOVINAC.mp3 | 2010-11-29 15:43 | 136M | |
![[SND]](/icons/sound2.gif) | 20101127 ARI UP.mp3 | 2010-11-29 15:43 | 174M | |
![[SND]](/icons/sound2.gif) | 20101120 VOLKAR.mp3 | 2010-11-22 17:01 | 161M | |
![[SND]](/icons/sound2.gif) | 20101120 JELENA.mp3 | 2010-11-22 17:00 | 155M | |
![[SND]](/icons/sound2.gif) | 20101119 PREPARIRAN KLAVIR.mp3 | 2010-11-22 17:00 | 171M | |
![[SND]](/icons/sound2.gif) | 101113 US BOMBS.mp3 | 2010-11-15 15:30 | 165M | |
![[SND]](/icons/sound2.gif) | 20101113 SIMON VENE.mp3 | 2010-11-15 15:30 | 120M | |
![[SND]](/icons/sound2.gif) | 20101106 GHOST-KM 2010.mp3 | 2010-11-08 15:08 | 263M | |
![[SND]](/icons/sound2.gif) | 101030 graffiti_20.00_01.mp3 | 2010-11-02 14:51 | 107M | |
![[SND]](/icons/sound2.gif) | 20101023 SOLOMON BURKE.mp3 | 2010-10-25 13:11 | 102M | |
![[SND]](/icons/sound2.gif) | 20101023 SLONOJZ.mp3 | 2010-10-25 13:10 | 108M | |
![[SND]](/icons/sound2.gif) | 20101017 VOZELJ.mp3 | 2010-10-18 17:20 | 110M | |
![[SND]](/icons/sound2.gif) | 20101017 BOGDAN.mp3 | 2010-10-18 17:20 | 113M | |
![[SND]](/icons/sound2.gif) | 20101009 NOAGE.mp3 | 2010-10-11 15:21 | 109M | |
![[SND]](/icons/sound2.gif) | 20101009 DINO.mp3 | 2010-10-11 15:20 | 111M | |
![[SND]](/icons/sound2.gif) | 101002 BASTIEN.mp3 | 2010-10-04 15:43 | 110M | |
![[SND]](/icons/sound2.gif) | 20101002 DJ GRAFITI.mp3 | 2010-10-04 15:42 | 107M | |
![[SND]](/icons/sound2.gif) | 100925 JIZAH.mp3 | 2010-09-27 14:18 | 110M | |
![[SND]](/icons/sound2.gif) | 100925 CHEMICAL BROTHERS.mp3 | 2010-09-27 14:18 | 113M | |
![[SND]](/icons/sound2.gif) | 20100923 US CHRISTMAS.mp3 | 2010-09-24 16:36 | 75M | |
![[SND]](/icons/sound2.gif) | 100918 DINO.mp3 | 2010-09-20 16:05 | 113M | |
![[SND]](/icons/sound2.gif) | 100918 MEDESKI MARTIN.mp3 | 2010-09-20 16:05 | 109M | |
![[SND]](/icons/sound2.gif) | 100911 BENIGAR.mp3 | 2010-09-13 15:48 | 116M | |
![[SND]](/icons/sound2.gif) | 100904 BORKA.mp3 | 2010-09-06 15:10 | 112M | |
![[SND]](/icons/sound2.gif) | 100828 OUTKAST.mp3 | 2010-08-30 14:35 | 111M | |
![[SND]](/icons/sound2.gif) | 100821 M.I.A..mp3 | 2010-08-23 14:40 | 120M | |
![[SND]](/icons/sound2.gif) | 100821 FAVELA FUNK.mp3 | 2010-08-23 14:40 | 100M | |
![[SND]](/icons/sound2.gif) | 20100819 FEO.mp3 | 2010-08-20 14:57 | 87M | |
![[SND]](/icons/sound2.gif) | 100814 JAPONSKA PSIHADELIJA2.mp3 | 2010-08-16 16:31 | 122M | |
![[SND]](/icons/sound2.gif) | 20100814 OBSKURITARNICA.mp3 | 2010-08-16 16:31 | 109M | |
![[SND]](/icons/sound2.gif) | 20100805 maco.mp3 | 2010-08-09 17:05 | 86M | |
![[SND]](/icons/sound2.gif) | 20100807 FLUFF FEST (1h 34).mp3 | 2010-08-09 16:22 | 87M | |
![[SND]](/icons/sound2.gif) | 100807 SIMONX (1h 59).mp3 | 2010-08-09 16:21 | 109M | |
![[SND]](/icons/sound2.gif) | 100731 JAPONSKA PSIHADELIJA.mp3 | 2010-08-02 17:24 | 120M | |
![[SND]](/icons/sound2.gif) | 100731 KUDURO.mp3 | 2010-08-02 17:24 | 110M | |
![[SND]](/icons/sound2.gif) | 100724 borka.mp3 | 2010-07-26 17:09 | 118M | |
![[SND]](/icons/sound2.gif) | 100724 antipop.mp3 | 2010-07-26 17:08 | 127M | |
![[SND]](/icons/sound2.gif) | 100722 steel.mp3 | 2010-07-23 13:05 | 83M | |
![[SND]](/icons/sound2.gif) | 100717 dj grafiti jizah.mp3 | 2010-07-19 13:14 | 109M | |
![[SND]](/icons/sound2.gif) | 100717 dj grafiti katarina.mp3 | 2010-07-19 13:13 | 111M | |
![[SND]](/icons/sound2.gif) | 100710 dj grafiti bogdan.mp3 | 2010-07-12 18:37 | 110M | |
![[SND]](/icons/sound2.gif) | 100710 dj grafititit.mp3 | 2010-07-12 18:37 | 112M | |
![[SND]](/icons/sound2.gif) | 100702 dj grafiti_002.mp3 | 2010-07-05 16:47 | 111M | |
![[SND]](/icons/sound2.gif) | DJ Grafitti Bob Ostertag Sobota 3.7.2010 ob 20h.mp3 | 2010-07-05 16:46 | 309M | |
![[SND]](/icons/sound2.gif) | 20100626 JELLO BIAFRA.mp3 | 2010-06-28 16:09 | 111M | |
![[SND]](/icons/sound2.gif) | 20100626 DINO.mp3 | 2010-06-28 16:08 | 109M | |
![[SND]](/icons/sound2.gif) | 20100612 wild style.mp3 | 2010-06-14 17:11 | 112M | |
![[SND]](/icons/sound2.gif) | 20100605 PHILIP GLAS.mp3 | 2010-06-07 15:42 | 110M | |
![[SND]](/icons/sound2.gif) | 20100605 DIO.mp3 | 2010-06-07 15:42 | 106M | |
![[SND]](/icons/sound2.gif) | 20100529 ZU.mp3 | 2010-05-31 15:48 | 92M | |
![[SND]](/icons/sound2.gif) | 20100529 BJORN SWIN.mp3 | 2010-05-31 15:48 | 113M | |
![[SND]](/icons/sound2.gif) | 20100508 ETHIOPIJSKI JAZZ.mp3 | 2010-05-10 16:00 | 219M | |
![[SND]](/icons/sound2.gif) | 20100501 IN THE RED.mp3 | 2010-05-03 18:51 | 105M | |
![[SND]](/icons/sound2.gif) | 20100501 wild style.mp3 | 2010-05-03 18:48 | 117M | |
![[SND]](/icons/sound2.gif) | 20100410 DAN DEACON.mp3 | 2010-04-12 17:24 | 107M | |
![[SND]](/icons/sound2.gif) | 20100410 GUDRUN GUT.mp3 | 2010-04-12 17:22 | 86M | |
![[SND]](/icons/sound2.gif) | 20100403 SUSA.mp3 | 2010-04-06 16:15 | 104M | |
![[SND]](/icons/sound2.gif) | 20100403 DOMACI JAZZ.mp3 | 2010-04-06 16:13 | 118M | |
![[SND]](/icons/sound2.gif) | 20100327 MAJA MATIC.mp3 | 2010-03-29 10:27 | 116M | |
![[SND]](/icons/sound2.gif) | 20100327 DINO.mp3 | 2010-03-29 10:25 | 110M | |
![[SND]](/icons/sound2.gif) | 20100313 JAZZ PO SVENSKA.mp3 | 2010-03-15 16:45 | 109M | |
![[SND]](/icons/sound2.gif) | 100313 PINA.mp3 | 2010-03-15 16:00 | 237M | |
![[SND]](/icons/sound2.gif) | 100306 JARMUSH.mp3 | 2010-03-08 16:02 | 120M | |
![[SND]](/icons/sound2.gif) | 100306 SAVSKI.mp3 | 2010-03-08 16:00 | 106M | |
![[SND]](/icons/sound2.gif) | 20100227 GRAFITI ANDREJ.mp3 | 2010-03-01 16:23 | 109M | |
![[SND]](/icons/sound2.gif) | 100227 JIZAH.mp3 | 2010-03-01 16:20 | 115M | |
![[SND]](/icons/sound2.gif) | 100213 prus.mp3 | 2010-02-15 16:52 | 220M | |
![[SND]](/icons/sound2.gif) | 20100213 PEBI NE STRELAT.mp3 | 2010-02-15 16:48 | 171M | |
![[SND]](/icons/sound2.gif) | 20100206 MOEBIUS.mp3 | 2010-02-09 16:07 | 159M | |
![[SND]](/icons/sound2.gif) | 20100206 ZIPI ZAOSTANKI.mp3 | 2010-02-09 16:04 | 213M | |
![[SND]](/icons/sound2.gif) | 100130 BORGHESIA.mp3 | 2010-02-01 18:49 | 223M | |
![[SND]](/icons/sound2.gif) | 20100130 RADIAN.mp3 | 2010-02-01 18:41 | 209M | |
![[SND]](/icons/sound2.gif) | 20100123 DJ GRAFITI.mp3 | 2010-01-25 13:23 | 104M | |
![[SND]](/icons/sound2.gif) | 100123 dj grafiti-grind madness at the bbc- 100120.mp3 | 2010-01-25 12:59 | 96M | |
![[SND]](/icons/sound2.gif) | 100109 JACK ROSE (2h 04).mp3 | 2010-01-12 15:05 | 114M | |
![[SND]](/icons/sound2.gif) | 100109 VIC CHESNUT.mp3 | 2010-01-12 15:03 | 110M | |
![[SND]](/icons/sound2.gif) | 100102 grafiti1.mp3 | 2010-01-04 18:01 | 112M | |
![[SND]](/icons/sound2.gif) | 100102 grafiti2.mp3 | 2010-01-04 18:00 | 107M | |
![[SND]](/icons/sound2.gif) | 091226 WILD STYLE (1h 52).mp3 | 2009-12-29 17:23 | 207M | |
![[SND]](/icons/sound2.gif) | 091226 RAP INVAZIJA.mp3 | 2009-12-29 17:20 | 1.1G | |
![[SND]](/icons/sound2.gif) | 091226 GRAFITI BOGDAN (1h 58).mp3 | 2009-12-29 17:02 | 109M | |
![[SND]](/icons/sound2.gif) | 20091212 DJ GRAFITI.mp3 | 2009-12-21 17:24 | 109M | |
![[SND]](/icons/sound2.gif) | 091212 DJ GRAFITI MAJA M.mp3 | 2009-12-21 17:22 | 110M | |
![[SND]](/icons/sound2.gif) | 20091205 JIZAH.mp3 | 2009-12-08 17:32 | 110M | |
![[SND]](/icons/sound2.gif) | 20091205 PISTOTNIK.mp3 | 2009-12-08 17:30 | 111M | |
![[SND]](/icons/sound2.gif) | 20091128 TOMAZIN.mp3 | 2009-11-30 14:41 | 98M | |
![[SND]](/icons/sound2.gif) | 20091128 TITP.mp3 | 2009-11-30 14:39 | 115M | |
![[SND]](/icons/sound2.gif) | 20091114 warp.mp3 | 2009-11-16 14:54 | 111M | |
![[SND]](/icons/sound2.gif) | 20091114 ostanki pistotnik.mp3 | 2009-11-16 14:51 | 106M | |
![[SND]](/icons/sound2.gif) | 20091024 JIZAH.mp3 | 2009-10-26 16:12 | 111M | |
![[SND]](/icons/sound2.gif) | 20091024 MATICICH (1h 58).mp3 | 2009-10-26 16:04 | 109M | |
![[SND]](/icons/sound2.gif) | 20091015 MUDHONEY.mp3 | 2009-10-16 15:20 | 82M | |
![[SND]](/icons/sound2.gif) | 20091010 JAZZ NOVITETE.mp3 | 2009-10-13 16:07 | 102M | |
![[SND]](/icons/sound2.gif) | 20091010 mazurek2.mp3 | 2009-10-13 15:41 | 110M | |
![[SND]](/icons/sound2.gif) | 20091008 ALI EN.mp3 | 2009-10-09 15:55 | 84M | |
![[SND]](/icons/sound2.gif) | 2009-10-03_grafiti20.mp3 | 2009-10-05 17:05 | 112M | |
![[SND]](/icons/sound2.gif) | 2009-10-03_grafiti-22.mp3 | 2009-10-05 16:57 | 115M | |
![[SND]](/icons/sound2.gif) | 20090912 FINSKA.mp3 | 2009-09-14 16:02 | 113M | |
![[SND]](/icons/sound2.gif) | 20090905 MAKEDONSKA SCENA.mp3 | 2009-09-07 14:29 | 119M | |
![[SND]](/icons/sound2.gif) | 090829 JAMES BLOOD ULMER.mp3 | 2009-08-31 15:25 | 93M | |
![[SND]](/icons/sound2.gif) | 20090822 TERENSKI POSNETKI.mp3 | 2009-08-24 13:35 | 108M | |
![[SND]](/icons/sound2.gif) | 090822 JOHN CAGE.mp3 | 2009-08-24 13:28 | 111M | |
![[SND]](/icons/sound2.gif) | 090808 JAZZ NOVITETE.mp3 | 2009-08-12 12:35 | 118M | |
![[SND]](/icons/sound2.gif) | 090808 NOT TWO.mp3 | 2009-08-11 18:03 | 96M | |
![[SND]](/icons/sound2.gif) | 20090521 STEFAN BETKE.mp3 | 2009-08-07 15:00 | 81M | |
![[SND]](/icons/sound2.gif) | 20090806 JARRING EFFECTS.mp3 | 2009-08-07 14:22 | 81M | |
![[SND]](/icons/sound2.gif) | 20090801 MAGNETBANDUNTERGRUND.mp3 | 2009-08-03 13:25 | 104M | |
![[SND]](/icons/sound2.gif) | 090801 TERENSKI POSNETKI.mp3 | 2009-08-03 13:15 | 109M | |
![[SND]](/icons/sound2.gif) | 20090723 MUNICIPAL WASTE.mp3 | 2009-07-27 13:34 | 86M | |
![[SND]](/icons/sound2.gif) | 090725 VILLAGE VANGUARD.mp3 | 2009-07-27 13:14 | 113M | |
![[SND]](/icons/sound2.gif) | 090725 SAJETA 2009.mp3 | 2009-07-27 13:07 | 110M | |
![[SND]](/icons/sound2.gif) | 20090711 mini hc fest.mp3 | 2009-07-20 14:49 | 108M | |
![[SND]](/icons/sound2.gif) | 20090711 southside fest.mp3 | 2009-07-20 14:44 | 108M | |
![[SND]](/icons/sound2.gif) | 090613 50 LET LJ JAZZA.mp3 | 2009-07-10 17:17 | 110M | |
![[SND]](/icons/sound2.gif) | 20090702 JAZZ SCENA.mp3 | 2009-07-10 17:06 | 82M | |
![[SND]](/icons/sound2.gif) | 090613 ROYSKOPP.mp3 | 2009-07-10 17:00 | 113M | |
![[SND]](/icons/sound2.gif) | 090704 AFROBEAT.mp3 | 2009-07-06 16:03 | 203M | |
![[SND]](/icons/sound2.gif) | 090625 DJ Grafiti- Odprta Kompilacija.mp3 | 2009-07-01 13:47 | 81M | |
![[SND]](/icons/sound2.gif) | 090627 DJ Grafiti- Pestilencemp3.mp3 | 2009-07-01 13:35 | 90M | |
![[SND]](/icons/sound2.gif) | grafiti_dinosaur.jr.mp3 | 2009-06-28 15:05 | 109M | |
![[SND]](/icons/sound2.gif) | 090606 POLIFONIJA.mp3 | 2009-06-12 16:27 | 108M | |
![[SND]](/icons/sound2.gif) | 20090606 HOLY FUCK.mp3 | 2009-06-12 16:14 | 98M | |
![[SND]](/icons/sound2.gif) | 090530 RAP NAD AFRIKO.mp3 | 2009-06-02 14:26 | 111M | |
![[SND]](/icons/sound2.gif) | 090530 EVAN PARKER.mp3 | 2009-06-02 14:17 | 107M | |
![[SND]](/icons/sound2.gif) | 20090502 AVSTRALIJA.mp3 | 2009-05-04 13:48 | 105M | |
![[SND]](/icons/sound2.gif) | 090502 MEKURIA.mp3 | 2009-05-04 13:43 | 113M | |
![[SND]](/icons/sound2.gif) | 0904011 freestyle battle.mp3 | 2009-04-16 14:57 | 189M | |
![[SND]](/icons/sound2.gif) | 0904011BUTTHOLE.mp3 | 2009-04-14 19:31 | 145M | |
![[SND]](/icons/sound2.gif) | 090404 NOVA SRBSKA.mp3 | 2009-04-08 17:18 | 112M | |
![[SND]](/icons/sound2.gif) | 090404 DJ GRAFITI JUNGLE D'N'B.mp3 | 2009-04-08 17:10 | 110M | |
![[SND]](/icons/sound2.gif) | 090307 SOULFLY.mp3 | 2009-03-30 15:44 | 112M | |
![[SND]](/icons/sound2.gif) | 090328 MASTODON.mp3 | 2009-03-30 14:36 | 138M | |
![[SND]](/icons/sound2.gif) | 090314 DJ GRAFITI WATTS.mp3 | 2009-03-30 14:12 | 103M | |
![[SND]](/icons/sound2.gif) | 090328 MIKKEL METAL.mp3 | 2009-03-30 13:57 | 110M | |
![[SND]](/icons/sound2.gif) | 090314 DJ GRAFITI CINEMATIC.mp3 | 2009-03-25 15:37 | 114M | |
![[SND]](/icons/sound2.gif) | 090314 DJ GRAFITI GYORGY LIGETTI.mp3 | 2009-03-25 15:28 | 103M | |
![[SND]](/icons/sound2.gif) | 09-02-28 DJ GRAFITI - DEZURNI KRIVCI.mp3 | 2009-03-06 15:48 | 126M | |
![[SND]](/icons/sound2.gif) | 080322-DJ_Hibridi_1.mp3 | 2009-02-22 13:31 | 268M | |
![[SND]](/icons/sound2.gif) | 090219-DJ_Hibridi_3.mp3 | 2009-02-20 11:47 | 209M | |
![[ ]](/icons/unknown.gif) | player.swf | 2008-10-26 13:20 | 5.1K | |
![[SND]](/icons/sound2.gif) | 081025-DJ_Hibridi_2.mp3 | 2008-10-26 13:11 | 274M | |
|